C23H43N3O3Si — CID 140644416
N-[3-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]cyclohexyl]-2-[hydroxy(dimethyl)silyl]acetamide (PubChem CID 140644416) has the molecular formula C23H43N3O3Si and a molecular weight of 437.70 g/mol. Its IUPAC name is N-[3-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]cyclohexyl]-2-[hydroxy(dimethyl)silyl]acetamide.
| Compound Name | N-[3-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]cyclohexyl]-2-[hydroxy(dimethyl)silyl]acetamide |
|---|---|
| PubChem CID | 140644416 |
| Molecular Formula | C23H43N3O3Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | N-[3-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]cyclohexyl]-2-[hydroxy(dimethyl)silyl]acetamide |
| SMILES | C[Si](C)(O)CC(=O)NC1CCCC(C(=O)N2CCC(C3CCCC(CN)C3)CC2)C1 |
| InChI | InChI=1S/C23H43N3O3Si/c1-30(2,29)16-22(27)25-21-8-4-7-20(14-21)23(28)26-11-9-18(10-12-26)19-6-3-5-17(13-19)15-24/h17-21,29H,3-16,24H2,1-2H3,(H,25,27) |
| InChIKey | KIVHWTJIBQFNJU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|