C23H43N3O2Si — CID 140644455
[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[4-[hydroxy(dimethyl)silyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methanone (PubChem CID 140644455) has the molecular formula C23H43N3O2Si and a molecular weight of 421.70 g/mol. Its IUPAC name is [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[4-[hydroxy(dimethyl)silyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methanone.
| Compound Name | [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[4-[hydroxy(dimethyl)silyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 140644455 |
| Molecular Formula | C23H43N3O2Si |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[4-[hydroxy(dimethyl)silyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methanone |
| SMILES | C[Si](C)(O)C1CCCC2NC(C(=O)N3CCC(C4CCCC(CN)C4)CC3)CC21 |
| InChI | InChI=1S/C23H43N3O2Si/c1-29(2,28)22-8-4-7-20-19(22)14-21(25-20)23(27)26-11-9-17(10-12-26)18-6-3-5-16(13-18)15-24/h16-22,25,28H,3-15,24H2,1-2H3 |
| InChIKey | FGHQAZIYNVCECV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|