C22H40BN3O3 — CID 140644379
[5-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]boronic acid (PubChem CID 140644379) has the molecular formula C22H40BN3O3 and a molecular weight of 405.39 g/mol. Its IUPAC name is [5-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]boronic acid.
| Compound Name | [5-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]boronic acid |
|---|---|
| PubChem CID | 140644379 |
| Molecular Formula | C22H40BN3O3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | [5-[4-[3-(aminomethyl)cyclohexyl]piperidine-1-carbonyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]boronic acid |
| SMILES | NCC1CCCC(C2CCN(C(=O)C3CCCC4NCC(B(O)O)CC43)CC2)C1 |
| InChI | InChI=1S/C22H40BN3O3/c24-13-15-3-1-4-17(11-15)16-7-9-26(10-8-16)22(27)19-5-2-6-21-20(19)12-18(14-25-21)23(28)29/h15-21,25,28-29H,1-14,24H2 |
| InChIKey | SJNLZHYDZGQQMF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|