C24H40N2O2 — CID 140646812
(E)-1-[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-3-(4-cyclopropyl-3-hydroxycyclohexyl)prop-2-en-1-one (PubChem CID 140646812) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is (E)-1-[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-3-(4-cyclopropyl-3-hydroxycyclohexyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-3-(4-cyclopropyl-3-hydroxycyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 140646812 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | (E)-1-[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-3-(4-cyclopropyl-3-hydroxycyclohexyl)prop-2-en-1-one |
| SMILES | NCC1CCCC(C2CCN(C(=O)/C=C/C3CCC(C4CC4)C(O)C3)CC2)C1 |
| InChI | InChI=1S/C24H40N2O2/c25-16-18-2-1-3-21(14-18)19-10-12-26(13-11-19)24(28)9-5-17-4-8-22(20-6-7-20)23(27)15-17/h5,9,17-23,27H,1-4,6-8,10-16,25H2/b9-5+ |
| InChIKey | SOBBNXKTYLJSHN-WEVVVXLNSA-N |
| XLogP | 3.73 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|