C24H44N2O3Si — CID 140644467
[4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[2-[[hydroxy(dimethyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanone (PubChem CID 140644467) has the molecular formula C24H44N2O3Si and a molecular weight of 436.71 g/mol. Its IUPAC name is [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[2-[[hydroxy(dimethyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanone.
| Compound Name | [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[2-[[hydroxy(dimethyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanone |
|---|---|
| PubChem CID | 140644467 |
| Molecular Formula | C24H44N2O3Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | [4-[3-(aminomethyl)cyclohexyl]piperidin-1-yl]-[2-[[hydroxy(dimethyl)silyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanone |
| SMILES | C[Si](C)(O)CC1CC2C(CCCC2C(=O)N2CCC(C3CCCC(CN)C3)CC2)O1 |
| InChI | InChI=1S/C24H44N2O3Si/c1-30(2,28)16-20-14-22-21(7-4-8-23(22)29-20)24(27)26-11-9-18(10-12-26)19-6-3-5-17(13-19)15-25/h17-23,28H,3-16,25H2,1-2H3 |
| InChIKey | SEOUABBCSBGBBG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|