C15H12F3N3O2 — CID 140648506
[(1S)-2,2,2-trifluoro-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate (PubChem CID 140648506) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate.
| Compound Name | [(1S)-2,2,2-trifluoro-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 140648506 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate |
| SMILES | C#Cc1cnn(C)c1NC(=O)O[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H12F3N3O2/c1-3-10-9-19-21(2)13(10)20-14(22)23-12(15(16,17)18)11-7-5-4-6-8-11/h1,4-9,12H,2H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | YMIRFZRVWUNMHR-LBPRGKRZSA-N |
| XLogP | 3.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|