C15H26 — CID 140650689
1-[(E)-hex-1-enyl]-4-[(E)-prop-1-enyl]cyclohexane (PubChem CID 140650689) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1-[(E)-hex-1-enyl]-4-[(E)-prop-1-enyl]cyclohexane.
| Compound Name | 1-[(E)-hex-1-enyl]-4-[(E)-prop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 140650689 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1-[(E)-hex-1-enyl]-4-[(E)-prop-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CCC(/C=C/CCCC)CC1 |
| InChI | InChI=1S/C15H26/c1-3-5-6-7-9-15-12-10-14(8-4-2)11-13-15/h4,7-9,14-15H,3,5-6,10-13H2,1-2H3/b8-4+,9-7+ |
| InChIKey | RDLUWVUKLPHSFM-QDJBHUIFSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|