C36H34N2 — CID 140654326
4-N,5-N-bis(2-tert-butylphenyl)pyrene-4,5-diimine (PubChem CID 140654326) has the molecular formula C36H34N2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-N,5-N-bis(2-tert-butylphenyl)pyrene-4,5-diimine.
| Compound Name | 4-N,5-N-bis(2-tert-butylphenyl)pyrene-4,5-diimine |
|---|---|
| PubChem CID | 140654326 |
| Molecular Formula | C36H34N2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-N,5-N-bis(2-tert-butylphenyl)pyrene-4,5-diimine |
| SMILES | CC(C)(C)c1ccccc1/N=c1/c(=N/c2ccccc2C(C)(C)C)c2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C36H34N2/c1-35(2,3)27-17-7-9-19-29(27)37-33-25-15-11-13-23-21-22-24-14-12-16-26(32(24)31(23)25)34(33)38-30-20-10-8-18-28(30)36(4,5)6/h7-22H,1-6H3/b37-33+,38-34+ |
| InChIKey | HNDKOYYOUJJAAM-YEQLPCBTSA-N |
| XLogP | 9.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|