C28H18Cl2N2Ni — CID 140654096
dichloronickel;4-N,5-N-diphenylpyrene-4,5-diimine (PubChem CID 140654096) has the molecular formula C28H18Cl2N2Ni and a molecular weight of 512.07 g/mol. Its IUPAC name is dichloronickel;4-N,5-N-diphenylpyrene-4,5-diimine.
| Compound Name | dichloronickel;4-N,5-N-diphenylpyrene-4,5-diimine |
|---|---|
| PubChem CID | 140654096 |
| Molecular Formula | C28H18Cl2N2Ni |
| Molecular Weight | 512.07 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | dichloronickel;4-N,5-N-diphenylpyrene-4,5-diimine |
| SMILES | Cl[Ni]Cl.c1ccc(/N=c2/c(=N/c3ccccc3)c3cccc4ccc5cccc2c5c43)cc1 |
| InChI | InChI=1S/C28H18N2.2ClH.Ni/c1-3-11-21(12-4-1)29-27-23-15-7-9-19-17-18-20-10-8-16-24(26(20)25(19)23)28(27)30-22-13-5-2-6-14-22;;;/h1-18H;2*1H;/q;;;+2/p-2/b29-27+,30-28+;;; |
| InChIKey | LHQSGLHTRLXESN-CRLMKPFESA-L |
| XLogP | 7.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.07 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|