C31H35O2S+ — CID 140655033
[4-(adamantane-1-carbonyloxy)-3,5-dimethylcyclohexa-1,3-dien-1-yl]-diphenylsulfanium (PubChem CID 140655033) has the molecular formula C31H35O2S+ and a molecular weight of 471.69 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyloxy)-3,5-dimethylcyclohexa-1,3-dien-1-yl]-diphenylsulfanium.
| Compound Name | [4-(adamantane-1-carbonyloxy)-3,5-dimethylcyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140655033 |
| Molecular Formula | C31H35O2S+ |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [4-(adamantane-1-carbonyloxy)-3,5-dimethylcyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
| SMILES | CC1=C(OC(=O)C23CC4CC(CC(C4)C2)C3)C(C)CC([S+](c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C31H35O2S/c1-21-13-28(34(26-9-5-3-6-10-26)27-11-7-4-8-12-27)14-22(2)29(21)33-30(32)31-18-23-15-24(19-31)17-25(16-23)20-31/h3-13,22-25H,14-20H2,1-2H3/q+1 |
| InChIKey | ZDACTIVTALIQRI-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|