C23H44N4O5S — CID 140655763
[(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium (PubChem CID 140655763) has the molecular formula C23H44N4O5S and a molecular weight of 488.70 g/mol. Its IUPAC name is [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium.
| Compound Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
|---|---|
| PubChem CID | 140655763 |
| Molecular Formula | C23H44N4O5S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.N#C[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C7H9N3O5S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-3-5-1-2-6-4-9(5)7(11)10(6)15-16(12,13)14/h5-16H2,1-4H3;5-6H,1-2,4H2,(H,12,13,14)/q+1;/p-1/t;5-,6+/m.0/s1 |
| InChIKey | UMEOOFDCDQYESY-WSMZBUKVSA-M |
| XLogP | 4.17 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|