C21H37N6O5S+ — CID 140656424
[(4S)-4-carboxy-4-[[4-methyl-2-[(1S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-5-carbonyl]amino]butyl]-(diaminomethylidene)azanium (PubChem CID 140656424) has the molecular formula C21H37N6O5S+ and a molecular weight of 485.63 g/mol. Its IUPAC name is [(4S)-4-carboxy-4-[[4-methyl-2-[(1S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-5-carbonyl]amino]butyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-carboxy-4-[[4-methyl-2-[(1S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-5-carbonyl]amino]butyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 140656424 |
| Molecular Formula | C21H37N6O5S+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [(4S)-4-carboxy-4-[[4-methyl-2-[(1S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-5-carbonyl]amino]butyl]-(diaminomethylidene)azanium |
| SMILES | Cc1nc([C@H](CC(C)C)NC(=O)OC(C)(C)C)sc1C(=O)N[C@@H](CCC[NH+]=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H36N6O5S/c1-11(2)10-14(27-20(31)32-21(4,5)6)17-25-12(3)15(33-17)16(28)26-13(18(29)30)8-7-9-24-19(22)23/h11,13-14H,7-10H2,1-6H3,(H,26,28)(H,27,31)(H,29,30)(H4,22,23,24)/p+1/t13-,14-/m0/s1 |
| InChIKey | QQJGLCLQLWYIBT-KBPBESRZSA-O |
| XLogP | 0.38 |
| TPSA | 183.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|