C18H21F2N5O — CID 140657167
5-[3-[[(1R,2S)-2-aminocyclohexyl]amino]-N,4-difluoroanilino]pyridine-3-carboxamide (PubChem CID 140657167) has the molecular formula C18H21F2N5O and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-2-aminocyclohexyl]amino]-N,4-difluoroanilino]pyridine-3-carboxamide.
| Compound Name | 5-[3-[[(1R,2S)-2-aminocyclohexyl]amino]-N,4-difluoroanilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140657167 |
| Molecular Formula | C18H21F2N5O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 5-[3-[[(1R,2S)-2-aminocyclohexyl]amino]-N,4-difluoroanilino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(N(F)c2ccc(F)c(N[C@@H]3CCCC[C@@H]3N)c2)c1 |
| InChI | InChI=1S/C18H21F2N5O/c19-14-6-5-12(8-17(14)24-16-4-2-1-3-15(16)21)25(20)13-7-11(18(22)26)9-23-10-13/h5-10,15-16,24H,1-4,21H2,(H2,22,26)/t15-,16+/m0/s1 |
| InChIKey | GQKWCEANIRCCPB-JKSUJKDBSA-N |
| XLogP | 3.02 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|