C11H13F2NOS — CID 140657334
4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 140657334) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is 4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | 4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 140657334 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | FC1(F)COC2(CCNCC2)c2sccc21 |
| InChI | InChI=1S/C11H13F2NOS/c12-11(13)7-15-10(2-4-14-5-3-10)9-8(11)1-6-16-9/h1,6,14H,2-5,7H2 |
| InChIKey | IGJYNRJBRWKKKT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |