C21H39IO3Si — CID 140658606
(6S,7S,9Z,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(2R)-1-iodopropan-2-yl]-7-methyl-1-oxacyclododec-9-en-2-one (PubChem CID 140658606) has the molecular formula C21H39IO3Si and a molecular weight of 494.53 g/mol. Its IUPAC name is (6S,7S,9Z,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(2R)-1-iodopropan-2-yl]-7-methyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,9Z,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(2R)-1-iodopropan-2-yl]-7-methyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 140658606 |
| Molecular Formula | C21H39IO3Si |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (6S,7S,9Z,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(2R)-1-iodopropan-2-yl]-7-methyl-1-oxacyclododec-9-en-2-one |
| SMILES | C[C@H]1C/C=C\C[C@H]([C@@H](C)CI)OC(=O)CCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39IO3Si/c1-16-11-8-9-12-18(17(2)15-22)24-20(23)14-10-13-19(16)25-26(6,7)21(3,4)5/h8-9,16-19H,10-15H2,1-7H3/b9-8-/t16-,17-,18+,19-/m0/s1 |
| InChIKey | VAYIESPUTOWMMB-QDRTXVNESA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|