C24H49NO3Si2 — CID 11762229
(8R,9R,9aS)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one (PubChem CID 11762229) has the molecular formula C24H49NO3Si2 and a molecular weight of 455.83 g/mol. Its IUPAC name is (8R,9R,9aS)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one.
| Compound Name | (8R,9R,9aS)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 11762229 |
| Molecular Formula | C24H49NO3Si2 |
| Molecular Weight | 455.83 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | (8R,9R,9aS)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H49NO3Si2/c1-18(17-27-29(8,9)23(2,3)4)22-19-14-15-21(26)25(19)16-12-13-20(22)28-30(10,11)24(5,6)7/h18-20,22H,12-17H2,1-11H3/t18-,19+,20-,22-/m1/s1 |
| InChIKey | NSSIVEGLFOTHBA-XAPVIXHLSA-N |
| XLogP | 6.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.83 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|