C15H30N2O2Si — CID 68501037
1-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]pyrrolidin-2-one (PubChem CID 68501037) has the molecular formula C15H30N2O2Si and a molecular weight of 298.50 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 68501037 |
| Molecular Formula | C15H30N2O2Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CNCC[C@H]1N1CCCC1=O |
| InChI | InChI=1S/C15H30N2O2Si/c1-15(2,3)20(4,5)19-13-11-16-9-8-12(13)17-10-6-7-14(17)18/h12-13,16H,6-11H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | LAZDVUZAAYUHJQ-OLZOCXBDSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|