C13H13FN2 — CID 140659152
4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine (PubChem CID 140659152) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine.
| Compound Name | 4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 140659152 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CC/C(=N\Cc2ccc(F)cc2)C=C1 |
| InChI | InChI=1S/C13H13FN2/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-7H,8-9,15H2/b16-13- |
| InChIKey | PIFOTDHXGGJLCG-SSZFMOIBSA-N |
| XLogP | 2.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|