C11H22N3+ — CID 140659361
1-tert-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium (PubChem CID 140659361) has the molecular formula C11H22N3+ and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-tert-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium.
| Compound Name | 1-tert-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 140659361 |
| Molecular Formula | C11H22N3+ |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 1-tert-butyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium |
| SMILES | CC(C)(C)N1CCC[N+]2=C1NCCC2 |
| InChI | InChI=1S/C11H21N3/c1-11(2,3)14-9-5-8-13-7-4-6-12-10(13)14/h4-9H2,1-3H3/p+1 |
| InChIKey | GMIDQSWQUMCQAA-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|