C9H18N3+ — CID 123783608
1-ethyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium (PubChem CID 123783608) has the molecular formula C9H18N3+ and a molecular weight of 168.26 g/mol. Its IUPAC name is 1-ethyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium.
| Compound Name | 1-ethyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 123783608 |
| Molecular Formula | C9H18N3+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-ethyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidin-5-ium |
| SMILES | CCN1CCC[N+]2=C1NCCC2 |
| InChI | InChI=1S/C9H17N3/c1-2-11-7-4-8-12-6-3-5-10-9(11)12/h2-8H2,1H3/p+1 |
| InChIKey | AAPJUEKLMYSSCH-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|