C21H14F3OS+ — CID 140660906
2-methyl-10-[3-(trifluoromethyl)phenyl]thioxanthen-10-ium-9-one (PubChem CID 140660906) has the molecular formula C21H14F3OS+ and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-methyl-10-[3-(trifluoromethyl)phenyl]thioxanthen-10-ium-9-one.
| Compound Name | 2-methyl-10-[3-(trifluoromethyl)phenyl]thioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 140660906 |
| Molecular Formula | C21H14F3OS+ |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-methyl-10-[3-(trifluoromethyl)phenyl]thioxanthen-10-ium-9-one |
| SMILES | Cc1ccc2c(c1)c(=O)c1ccccc1[s+]2-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F3OS/c1-13-9-10-19-17(11-13)20(25)16-7-2-3-8-18(16)26(19)15-6-4-5-14(12-15)21(22,23)24/h2-12H,1H3/q+1 |
| InChIKey | DAUYVCOBHSFUQD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|