C25H21F6NO5S3 — CID 53375276
bis(trifluoromethylsulfonyl)azanide;10-(4-methylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one (PubChem CID 53375276) has the molecular formula C25H21F6NO5S3 and a molecular weight of 625.63 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;10-(4-methylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;10-(4-methylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 53375276 |
| Molecular Formula | C25H21F6NO5S3 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;10-(4-methylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one |
| SMILES | Cc1ccc(-[s+]2c3ccccc3c(=O)c3cc(C(C)C)ccc32)cc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H21OS.C2F6NO4S2/c1-15(2)17-10-13-22-20(14-17)23(24)19-6-4-5-7-21(19)25(22)18-11-8-16(3)9-12-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-15H,1-3H3;/q+1;-1 |
| InChIKey | AMNSHJSZVRIHGE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 99.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|