C20H12F5S+ — CID 159769621
2,8-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)dibenzothiophen-5-ium (PubChem CID 159769621) has the molecular formula C20H12F5S+ and a molecular weight of 379.37 g/mol. Its IUPAC name is 2,8-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)dibenzothiophen-5-ium.
| Compound Name | 2,8-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 159769621 |
| Molecular Formula | C20H12F5S+ |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2,8-dimethyl-5-(2,3,4,5,6-pentafluorophenyl)dibenzothiophen-5-ium |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1[s+]2-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H12F5S/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14(12)26(13)20-18(24)16(22)15(21)17(23)19(20)25/h3-8H,1-2H3/q+1 |
| InChIKey | NFYJMOIYLHDGSM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|