C19H13Br2F6PS — CID 162318846
2,8-dibromo-5-(4-methylphenyl)dibenzothiophen-5-ium hexafluorophosphate (PubChem CID 162318846) has the molecular formula C19H13Br2F6PS and a molecular weight of 578.15 g/mol. Its IUPAC name is 2,8-dibromo-5-(4-methylphenyl)dibenzothiophen-5-ium hexafluorophosphate.
| Compound Name | 2,8-dibromo-5-(4-methylphenyl)dibenzothiophen-5-ium hexafluorophosphate |
|---|---|
| PubChem CID | 162318846 |
| Molecular Formula | C19H13Br2F6PS |
| Molecular Weight | 578.15 g/mol |
| Exact Mass | 575.87 |
| IUPAC Name | 2,8-dibromo-5-(4-methylphenyl)dibenzothiophen-5-ium hexafluorophosphate |
| SMILES | Cc1ccc(-[s+]2c3ccc(Br)cc3c3cc(Br)ccc32)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C19H13Br2S.F6P/c1-12-2-6-15(7-3-12)22-18-8-4-13(20)10-16(18)17-11-14(21)5-9-19(17)22;1-7(2,3,4,5)6/h2-11H,1H3;/q+1;-1 |
| InChIKey | FEBPNUUNYYEYLN-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.15 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|