C20H27BrN4O2Si — CID 140662743
4-bromo-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-1H-indole-7-carboxamide (PubChem CID 140662743) has the molecular formula C20H27BrN4O2Si and a molecular weight of 463.45 g/mol. Its IUPAC name is 4-bromo-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-1H-indole-7-carboxamide.
| Compound Name | 4-bromo-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 140662743 |
| Molecular Formula | C20H27BrN4O2Si |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4-bromo-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-1H-indole-7-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc(-c2cc3c(Br)ccc(C(N)=O)c3[nH]2)cn1 |
| InChI | InChI=1S/C20H27BrN4O2Si/c1-20(2,3)28(4,5)27-9-8-25-12-13(11-23-25)17-10-15-16(21)7-6-14(19(22)26)18(15)24-17/h6-7,10-12,24H,8-9H2,1-5H3,(H2,22,26) |
| InChIKey | QCDJWOKQOUGRMT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|