C18H31ClN2O10Pt — CID 140666650
[(1R,2R)-2-azanidylcyclohexyl]azanide;2-chloro-2-[3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]propanedioic acid;platinum(2+) (PubChem CID 140666650) has the molecular formula C18H31ClN2O10Pt and a molecular weight of 665.98 g/mol. Its IUPAC name is [(1R,2R)-2-azanidylcyclohexyl]azanide;2-chloro-2-[3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]propanedioic acid;platinum(2+).
| Compound Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;2-chloro-2-[3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]propanedioic acid;platinum(2+) |
|---|---|
| PubChem CID | 140666650 |
| Molecular Formula | C18H31ClN2O10Pt |
| Molecular Weight | 665.98 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;2-chloro-2-[3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]propanedioic acid;platinum(2+) |
| SMILES | O=C(O)C(Cl)(CCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)C(=O)O.[NH-][C@@H]1CCCC[C@H]1[NH-].[Pt+2] |
| InChI | InChI=1S/C12H19ClO10.C6H12N2.Pt/c13-12(10(18)19,11(20)21)2-1-3-22-9-8(17)7(16)6(15)5(4-14)23-9;7-5-3-1-2-4-6(5)8;/h5-9,14-17H,1-4H2,(H,18,19)(H,20,21);5-8H,1-4H2;/q;-2;+2/t5-,6-,7+,8+,9?;5-,6-;/m11./s1 |
| InChIKey | OHXGPWAPYPTHOX-YFYPLSHKSA-N |
| XLogP | 0.13 |
| TPSA | 221.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.98 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|