C26H34N4O4 — CID 140666819
N-[2-(dimethylamino)ethyl]-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carboxamide (PubChem CID 140666819) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 140666819 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-9,15-dimethyl-11,16-dioxo-7-oxa-10,15-diazatricyclo[15.3.1.12,6]docosa-1(21),2(22),3,5,17,19-hexaene-14-carboxamide |
| SMILES | CC1COc2cccc(c2)-c2cccc(c2)C(=O)N(C)C(C(=O)NCCN(C)C)CCC(=O)N1 |
| InChI | InChI=1S/C26H34N4O4/c1-18-17-34-22-10-6-8-20(16-22)19-7-5-9-21(15-19)26(33)30(4)23(11-12-24(31)28-18)25(32)27-13-14-29(2)3/h5-10,15-16,18,23H,11-14,17H2,1-4H3,(H,27,32)(H,28,31) |
| InChIKey | QIVFFXGLAUUNON-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |