C24H36GeS2 — CID 140670585
7-cyclohexyl-7-(2-ethylhexyl)-4,10-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 140670585) has the molecular formula C24H36GeS2 and a molecular weight of 461.30 g/mol. Its IUPAC name is 7-cyclohexyl-7-(2-ethylhexyl)-4,10-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-cyclohexyl-7-(2-ethylhexyl)-4,10-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 140670585 |
| Molecular Formula | C24H36GeS2 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 7-cyclohexyl-7-(2-ethylhexyl)-4,10-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCC(CC)C[Ge]1(C2CCCCC2)c2cc(C)sc2-c2sc(C)cc21 |
| InChI | InChI=1S/C24H36GeS2/c1-5-7-11-19(6-2)16-25(20-12-9-8-10-13-20)21-14-17(3)26-23(21)24-22(25)15-18(4)27-24/h14-15,19-20H,5-13,16H2,1-4H3 |
| InChIKey | HVVTWKUBLWQPDB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |