C22H28GeS3 — CID 140670594
7-(2-ethylhexyl)-4,10-dimethyl-7-thiophen-2-yl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 140670594) has the molecular formula C22H28GeS3 and a molecular weight of 461.28 g/mol. Its IUPAC name is 7-(2-ethylhexyl)-4,10-dimethyl-7-thiophen-2-yl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-(2-ethylhexyl)-4,10-dimethyl-7-thiophen-2-yl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 140670594 |
| Molecular Formula | C22H28GeS3 |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 7-(2-ethylhexyl)-4,10-dimethyl-7-thiophen-2-yl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCC(CC)C[Ge]1(c2cccs2)c2cc(C)sc2-c2sc(C)cc21 |
| InChI | InChI=1S/C22H28GeS3/c1-5-7-9-17(6-2)14-23(20-10-8-11-24-20)18-12-15(3)25-21(18)22-19(23)13-16(4)26-22/h8,10-13,17H,5-7,9,14H2,1-4H3 |
| InChIKey | FSGNFIBESOZEPI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |