C28H29F7N4O4 — CID 140670870
1-[(1S)-1-cyano-2-methylpropyl]-5,5-difluoro-2-[4-[4-(morpholine-4-carbonyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide (PubChem CID 140670870) has the molecular formula C28H29F7N4O4 and a molecular weight of 618.55 g/mol. Its IUPAC name is 1-[(1S)-1-cyano-2-methylpropyl]-5,5-difluoro-2-[4-[4-(morpholine-4-carbonyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-[(1S)-1-cyano-2-methylpropyl]-5,5-difluoro-2-[4-[4-(morpholine-4-carbonyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140670870 |
| Molecular Formula | C28H29F7N4O4 |
| Molecular Weight | 618.55 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 1-[(1S)-1-cyano-2-methylpropyl]-5,5-difluoro-2-[4-[4-(morpholine-4-carbonyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide |
| SMILES | CC(C)[C@H](C#N)C1(C(N)=O)CC(F)(F)CCC1c1oc(C(F)(F)C(F)(F)F)nc1-c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H29F7N4O4/c1-15(2)19(13-36)26(23(37)41)14-25(29,30)8-7-18(26)21-20(38-24(43-21)27(31,32)28(33,34)35)16-3-5-17(6-4-16)22(40)39-9-11-42-12-10-39/h3-6,15,18-19H,7-12,14H2,1-2H3,(H2,37,41)/t18?,19-,26?/m0/s1 |
| InChIKey | SZNJRTGQIHCYPQ-XWJIAHPJSA-N |
| XLogP | 5.64 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|