C27H27F7N4O4 — CID 144828324
N-(1-cyanocyclopropyl)-3,3-difluorocyclohexane-1-carboxamide;morpholin-4-yl-[4-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-4-yl]phenyl]methanone (PubChem CID 144828324) has the molecular formula C27H27F7N4O4 and a molecular weight of 604.52 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-3,3-difluorocyclohexane-1-carboxamide;morpholin-4-yl-[4-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-4-yl]phenyl]methanone.
| Compound Name | N-(1-cyanocyclopropyl)-3,3-difluorocyclohexane-1-carboxamide;morpholin-4-yl-[4-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-4-yl]phenyl]methanone |
|---|---|
| PubChem CID | 144828324 |
| Molecular Formula | C27H27F7N4O4 |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | N-(1-cyanocyclopropyl)-3,3-difluorocyclohexane-1-carboxamide;morpholin-4-yl-[4-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-oxazol-4-yl]phenyl]methanone |
| SMILES | N#CC1(NC(=O)C2CCCC(F)(F)C2)CC1.O=C(c1ccc(-c2coc(C(F)(F)C(F)(F)F)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H13F5N2O3.C11H14F2N2O/c17-15(18,16(19,20)21)14-22-12(9-26-14)10-1-3-11(4-2-10)13(24)23-5-7-25-8-6-23;12-11(13)3-1-2-8(6-11)9(16)15-10(7-14)4-5-10/h1-4,9H,5-8H2;8H,1-6H2,(H,15,16) |
| InChIKey | LOCVASXALXUQJU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|