C10H19NO4 — CID 140676419
[3-hydroxy-3-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate (PubChem CID 140676419) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is [3-hydroxy-3-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-hydroxy-3-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140676419 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | [3-hydroxy-3-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CC(O)(CO)C1 |
| InChI | InChI=1S/C10H19NO4/c1-9(2,3)11-8(13)15-7-4-10(14,5-7)6-12/h7,12,14H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | BIVZGISOBRBQGL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |