C21H10F4N4OPt — CID 140680267
bis[6-(3,5-difluoro-2-pyridinyl)-2-pyridinyl]methanone;platinum (PubChem CID 140680267) has the molecular formula C21H10F4N4OPt and a molecular weight of 605.41 g/mol. Its IUPAC name is bis[6-(3,5-difluoro-2-pyridinyl)-2-pyridinyl]methanone;platinum.
| Compound Name | bis[6-(3,5-difluoro-2-pyridinyl)-2-pyridinyl]methanone;platinum |
|---|---|
| PubChem CID | 140680267 |
| Molecular Formula | C21H10F4N4OPt |
| Molecular Weight | 605.41 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | bis[6-(3,5-difluoro-2-pyridinyl)-2-pyridinyl]methanone;platinum |
| SMILES | O=C(c1cccc(-c2ncc(F)cc2F)n1)c1cccc(-c2ncc(F)cc2F)n1.[Pt] |
| InChI | InChI=1S/C21H10F4N4O.Pt/c22-11-7-13(24)19(26-9-11)15-3-1-5-17(28-15)21(30)18-6-2-4-16(29-18)20-14(25)8-12(23)10-27-20;/h1-10H; |
| InChIKey | YHVVCYQZJYIRBB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |