C29H26CuN5O2S+ — CID 140681952
copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,17,18-triaza-11-azanidatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol (PubChem CID 140681952) has the molecular formula C29H26CuN5O2S+ and a molecular weight of 572.17 g/mol. Its IUPAC name is copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,17,18-triaza-11-azanidatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol.
| Compound Name | copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,17,18-triaza-11-azanidatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 140681952 |
| Molecular Formula | C29H26CuN5O2S+ |
| Molecular Weight | 572.17 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-(3,17,18-triaza-11-azanidatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-ylmethyl)phenol |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(CN2Cc3cccc(n3)C[N-]Cc3cccc(n3)C2)c1O.[Cu+2] |
| InChI | InChI=1S/C29H26N5O2S.Cu/c1-36-26-13-19(29-33-25-10-2-3-11-27(25)37-29)12-20(28(26)35)16-34-17-23-8-4-6-21(31-23)14-30-15-22-7-5-9-24(18-34)32-22;/h2-13,35H,14-18H2,1H3;/q-1;+2 |
| InChIKey | PHDMDNPTGUYYEB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.17 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|