C30H29CuN5O2S+2 — CID 140681955
copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-[(11-methyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl)methyl]phenol (PubChem CID 140681955) has the molecular formula C30H29CuN5O2S+2 and a molecular weight of 587.21 g/mol. Its IUPAC name is copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-[(11-methyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl)methyl]phenol.
| Compound Name | copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-[(11-methyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 140681955 |
| Molecular Formula | C30H29CuN5O2S+2 |
| Molecular Weight | 587.21 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | copper 4-(1,3-benzothiazol-2-yl)-2-methoxy-6-[(11-methyl-3,11,17,18-tetrazatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaen-3-yl)methyl]phenol |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(CN2Cc3cccc(n3)CN(C)Cc3cccc(n3)C2)c1O.[Cu+2] |
| InChI | InChI=1S/C30H29N5O2S.Cu/c1-34-16-22-7-5-9-24(31-22)18-35(19-25-10-6-8-23(17-34)32-25)15-21-13-20(14-27(37-2)29(21)36)30-33-26-11-3-4-12-28(26)38-30;/h3-14,36H,15-19H2,1-2H3;/q;+2 |
| InChIKey | OTIOXPAZPPQVDJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.21 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|