C11H16F3NO4 — CID 140682188
[(2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140682188) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is [(2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140682188 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [(2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)C[C@](N)(OC(=O)C(F)(F)F)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C11H16F3NO4/c1-6(2)4-10(15,7(16)9(3)5-18-9)19-8(17)11(12,13)14/h6H,4-5,15H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | QIQBEKKFESWLAT-ZJUUUORDSA-N |
| XLogP | 1.15 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|