C18H30N2O3 — CID 140684554
1-[(3S)-4-acetyl-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 140684554) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(3S)-4-acetyl-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[(3S)-4-acetyl-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 140684554 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[(3S)-4-acetyl-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | CC(=O)N1C2CCCCC2N(C(=O)CC2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C18H30N2O3/c1-13-12-19(18(22)11-15-7-9-23-10-8-15)16-5-3-4-6-17(16)20(13)14(2)21/h13,15-17H,3-12H2,1-2H3/t13-,16?,17?/m0/s1 |
| InChIKey | CAUCJYUTGFYJEM-IGEOTXOUSA-N |
| XLogP | 2.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |