C20H36N2O3 — CID 140684346
1-[(2S)-4-[(3,5-dimethoxycyclohexyl)methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684346) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[(2S)-4-[(3,5-dimethoxycyclohexyl)methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-[(3,5-dimethoxycyclohexyl)methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684346 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[(2S)-4-[(3,5-dimethoxycyclohexyl)methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | COC1CC(CN2C[C@H](C)N(C(C)=O)C3CCCCC32)CC(OC)C1 |
| InChI | InChI=1S/C20H36N2O3/c1-14-12-21(13-16-9-17(24-3)11-18(10-16)25-4)19-7-5-6-8-20(19)22(14)15(2)23/h14,16-20H,5-13H2,1-4H3/t14-,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | JJFVTZMTRQACMG-XSKKXZQRSA-N |
| XLogP | 2.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |