C19H32N2O3 — CID 140684734
1-[(2S)-4-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ylmethyl)-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684734) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(2S)-4-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ylmethyl)-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ylmethyl)-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684734 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 1-[(2S)-4-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ylmethyl)-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCCCC2N(CC2CCCC3OCOC23)C[C@@H]1C |
| InChI | InChI=1S/C19H32N2O3/c1-13-10-20(11-15-6-5-9-18-19(15)24-12-23-18)16-7-3-4-8-17(16)21(13)14(2)22/h13,15-19H,3-12H2,1-2H3/t13-,15?,16?,17?,18?,19?/m0/s1 |
| InChIKey | LEVFOOVPWKPRKX-RLWQEURSSA-N |
| XLogP | 2.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |