C16H27NO3 — CID 140688186
(E)-5-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pent-2-enamide (PubChem CID 140688186) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (E)-5-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pent-2-enamide.
| Compound Name | (E)-5-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pent-2-enamide |
|---|---|
| PubChem CID | 140688186 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (E)-5-(3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pent-2-enamide |
| SMILES | CC(C)CNC(=O)/C=C/CCC1CCC2OCOC2C1 |
| InChI | InChI=1S/C16H27NO3/c1-12(2)10-17-16(18)6-4-3-5-13-7-8-14-15(9-13)20-11-19-14/h4,6,12-15H,3,5,7-11H2,1-2H3,(H,17,18)/b6-4+ |
| InChIKey | BFTLAQGEWGCUMT-GQCTYLIASA-N |
| XLogP | 2.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|