C16H29NO6 — CID 155735508
(E)-6-[(3R,6S)-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-(2-methylpropyl)hex-2-enamide (PubChem CID 155735508) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is (E)-6-[(3R,6S)-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-(2-methylpropyl)hex-2-enamide.
| Compound Name | (E)-6-[(3R,6S)-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-(2-methylpropyl)hex-2-enamide |
|---|---|
| PubChem CID | 155735508 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (E)-6-[(3R,6S)-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-(2-methylpropyl)hex-2-enamide |
| SMILES | CC(C)CNC(=O)/C=C/CCCOC1O[C@@H](CO)C(O)C[C@H]1O |
| InChI | InChI=1S/C16H29NO6/c1-11(2)9-17-15(21)6-4-3-5-7-22-16-13(20)8-12(19)14(10-18)23-16/h4,6,11-14,16,18-20H,3,5,7-10H2,1-2H3,(H,17,21)/b6-4+/t12?,13-,14+,16?/m1/s1 |
| InChIKey | GQTWPWNNIPBFTF-MZGYFSJQSA-N |
| XLogP | -0.06 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|