C44H26GeN4OPdS- — CID 140691420
CID 140691420 (PubChem CID 140691420) has the molecular formula C44H26GeN4OPdS- and a molecular weight of 837.82 g/mol.
| Compound Name | CID 140691420 |
|---|---|
| PubChem CID | 140691420 |
| Molecular Formula | C44H26GeN4OPdS- |
| Molecular Weight | 837.82 g/mol |
| Exact Mass | 838.01 |
| IUPAC Name | — |
| SMILES | [Pd].[c-]1ccccc1-c1ccc2occ(-n3c4ccccc4c4cc5sc6c7ccccc7n([Ge](c7ccccc7)c7ccccc7)c6c5nc43)c2n1 |
| InChI | InChI=1S/C44H26GeN4OS.Pd/c1-4-14-28(15-5-1)34-24-25-38-40(46-34)37(27-50-38)48-35-22-12-10-20-31(35)33-26-39-41(47-44(33)48)42-43(51-39)32-21-11-13-23-36(32)49(42)45(29-16-6-2-7-17-29)30-18-8-3-9-19-30;/h1-14,16-27H;/q-1; |
| InChIKey | YJXDVRBGOWCIDK-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.82 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|