C41H38F2O6S — CID 140692414
(2,5-difluorophenyl)-[(2S,3S,4R,5R,6R)-3-hydroxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone (PubChem CID 140692414) has the molecular formula C41H38F2O6S and a molecular weight of 696.81 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[(2S,3S,4R,5R,6R)-3-hydroxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[(2S,3S,4R,5R,6R)-3-hydroxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
|---|---|
| PubChem CID | 140692414 |
| Molecular Formula | C41H38F2O6S |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | (2,5-difluorophenyl)-[(2S,3S,4R,5R,6R)-3-hydroxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
| SMILES | Cc1ccc(S[C@@]2(C(=O)c3cc(F)ccc3F)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C41H38F2O6S/c1-28-17-20-33(21-18-28)50-41(39(44)34-23-32(42)19-22-35(34)43)40(45)38(48-26-31-15-9-4-10-16-31)37(47-25-30-13-7-3-8-14-30)36(49-41)27-46-24-29-11-5-2-6-12-29/h2-23,36-38,40,45H,24-27H2,1H3/t36-,37-,38+,40+,41-/m1/s1 |
| InChIKey | KJLIEBAXCXRJCM-LRGWFDJASA-N |
| XLogP | 8.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |