C29H27F7N2O6S2 — CID 140692434
(2S,3R)-1-fluoro-4-methyl-2,3-dinaphthalen-1-yl-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (PubChem CID 140692434) has the molecular formula C29H27F7N2O6S2 and a molecular weight of 696.66 g/mol. Its IUPAC name is (2S,3R)-1-fluoro-4-methyl-2,3-dinaphthalen-1-yl-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
| Compound Name | (2S,3R)-1-fluoro-4-methyl-2,3-dinaphthalen-1-yl-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 140692434 |
| Molecular Formula | C29H27F7N2O6S2 |
| Molecular Weight | 696.66 g/mol |
| Exact Mass | 696.12 |
| IUPAC Name | (2S,3R)-1-fluoro-4-methyl-2,3-dinaphthalen-1-yl-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| SMILES | C[N+]12CC[N+](F)(CC1)[C@@H](c1cccc3ccccc13)[C@H]2c1cccc2ccccc12.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H27FN2.2CHF3O3S/c1-29-16-18-30(28,19-17-29)27(25-15-7-11-21-9-3-5-13-23(21)25)26(29)24-14-6-10-20-8-2-4-12-22(20)24;2*2-1(3,4)8(5,6)7/h2-15,26-27H,16-19H2,1H3;2*(H,5,6,7)/q+2;;/p-2/t26-,27+,29?,30?;;/m1../s1 |
| InChIKey | KFAKGOBGTRQGJX-MHHBSVCBSA-L |
| XLogP | 6.05 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|