C23H21F13N2O6S2 — CID 140692454
(2R,3R)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (PubChem CID 140692454) has the molecular formula C23H21F13N2O6S2 and a molecular weight of 732.54 g/mol. Its IUPAC name is (2R,3R)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
| Compound Name | (2R,3R)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 140692454 |
| Molecular Formula | C23H21F13N2O6S2 |
| Molecular Weight | 732.54 g/mol |
| Exact Mass | 732.06 |
| IUPAC Name | (2R,3R)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| SMILES | C[N+]12CC[N+](F)(CC1)[C@H](c1ccccc1C(F)(F)F)[C@H]2c1ccccc1C(F)(F)F.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H21F7N2.2CHF3O3S/c1-29-10-12-30(28,13-11-29)19(15-7-3-5-9-17(15)21(25,26)27)18(29)14-6-2-4-8-16(14)20(22,23)24;2*2-1(3,4)8(5,6)7/h2-9,18-19H,10-13H2,1H3;2*(H,5,6,7)/q+2;;/p-2/t18-,19-,29?,30?;;/m1../s1 |
| InChIKey | XQAZWBTULOYPLQ-YUZNETOQSA-L |
| XLogP | 5.78 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|