C21H21F6N2+ — CID 140692461
(2R,3R)-1-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 140692461) has the molecular formula C21H21F6N2+ and a molecular weight of 415.40 g/mol. Its IUPAC name is (2R,3R)-1-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-4-aza-1-azoniabicyclo[2.2.2]octane.
| Compound Name | (2R,3R)-1-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-4-aza-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 140692461 |
| Molecular Formula | C21H21F6N2+ |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2R,3R)-1-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | C[N+]12CCN(CC1)[C@H](c1ccccc1C(F)(F)F)[C@H]2c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21F6N2/c1-29-12-10-28(11-13-29)18(14-6-2-4-8-16(14)20(22,23)24)19(29)15-7-3-5-9-17(15)21(25,26)27/h2-9,18-19H,10-13H2,1H3/q+1/t18-,19-/m1/s1 |
| InChIKey | SKVVWWIPDNIMHI-RTBURBONSA-N |
| XLogP | 5.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|