C13H15F3N2 — CID 69040978
1-ethenyl-2-[2-(trifluoromethyl)phenyl]piperazine (PubChem CID 69040978) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-ethenyl-2-[2-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-ethenyl-2-[2-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 69040978 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-ethenyl-2-[2-(trifluoromethyl)phenyl]piperazine |
| SMILES | C=CN1CCNCC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2/c1-2-18-8-7-17-9-12(18)10-5-3-4-6-11(10)13(14,15)16/h2-6,12,17H,1,7-9H2 |
| InChIKey | PVVXZWZATVQSQO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |