C21H21F7N2+2 — CID 90118997
(2S,3S)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 90118997) has the molecular formula C21H21F7N2+2 and a molecular weight of 434.40 g/mol. Its IUPAC name is (2S,3S)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | (2S,3S)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 90118997 |
| Molecular Formula | C21H21F7N2+2 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (2S,3S)-1-fluoro-4-methyl-2,3-bis[2-(trifluoromethyl)phenyl]-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | C[N+]12CC[N+](F)(CC1)[C@@H](c1ccccc1C(F)(F)F)[C@@H]2c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H21F7N2/c1-29-10-12-30(28,13-11-29)19(15-7-3-5-9-17(15)21(25,26)27)18(29)14-6-2-4-8-16(14)20(22,23)24/h2-9,18-19H,10-13H2,1H3/q+2/t18-,19-,29?,30?/m0/s1 |
| InChIKey | UJQGRQVYGKVGHT-QKECBOTDSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|