C18H15F3N2O2 — CID 140695800
3-[2,4-dimethoxy-6-(2-phenylethenyl)phenyl]-3-(trifluoromethyl)diazirine (PubChem CID 140695800) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 3-[2,4-dimethoxy-6-(2-phenylethenyl)phenyl]-3-(trifluoromethyl)diazirine.
| Compound Name | 3-[2,4-dimethoxy-6-(2-phenylethenyl)phenyl]-3-(trifluoromethyl)diazirine |
|---|---|
| PubChem CID | 140695800 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-[2,4-dimethoxy-6-(2-phenylethenyl)phenyl]-3-(trifluoromethyl)diazirine |
| SMILES | COc1cc(C=Cc2ccccc2)c(C2(C(F)(F)F)N=N2)c(OC)c1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-24-14-10-13(9-8-12-6-4-3-5-7-12)16(15(11-14)25-2)17(22-23-17)18(19,20)21/h3-11H,1-2H3 |
| InChIKey | HCWMACNIDVUVRJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|