C18H26BF6P — CID 140696633
dicyclohexyl-(3,5-difluorophenyl)phosphanium tetrafluoroborate (PubChem CID 140696633) has the molecular formula C18H26BF6P and a molecular weight of 398.18 g/mol. Its IUPAC name is dicyclohexyl-(3,5-difluorophenyl)phosphanium tetrafluoroborate.
| Compound Name | dicyclohexyl-(3,5-difluorophenyl)phosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 140696633 |
| Molecular Formula | C18H26BF6P |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | dicyclohexyl-(3,5-difluorophenyl)phosphanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.Fc1cc(F)cc([PH+](C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C18H25F2P.BF4/c19-14-11-15(20)13-18(12-14)21(16-7-3-1-4-8-16)17-9-5-2-6-10-17;2-1(3,4)5/h11-13,16-17H,1-10H2;/q;-1/p+1 |
| InChIKey | QSKUIFZPGLCDFN-UHFFFAOYSA-O |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|